cas: 1375303-05-1 — see every product listed under this CAS number, including other names
2-Butoxy-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1375303-05-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627393-1G |
| cas | 1375303-05-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1653.60 Pln | |
| Fluorochem | 5g | 4819.15 Pln |
| delivery time | 3-4 weeks |
|---|
2-butoxy-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1375303-05-1) is a chemical compound with the molecular formula C16H26BNO3 and a molecular weight of 291.2 g/mol. IUPAC name: 2-butoxy-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: USNVEVYTNAMJOH-UHFFFAOYSA-N.
| Molecular formula | C16H26BNO3 |
|---|---|
| Molecular weight | 291.2 g/mol |
| IUPAC name | 2-butoxy-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | USNVEVYTNAMJOH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)OCCCC)C |
Computed by PubChem (NCBI)