cas: 1029684-36-3 — see every product listed under this CAS number, including other names
2-Chloro-1-(tetrahydro-2H-pyran-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-imidazole 95+% (CAS 1029684-36-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A979427-100mg |
| cas | 1029684-36-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 442.69 Pln | |
| Ambeed | 250mg | 743.06 Pln | |
| Ambeed | 1g | 2105.88 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A979427 |
2-chloro-1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazole (CAS 1029684-36-3) is a chemical compound with the molecular formula C14H22BClN2O3 and a molecular weight of 312.60 g/mol. IUPAC name: 2-chloro-1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazole. InChIKey: PWGDGTMRINKIRS-UHFFFAOYSA-N.
| Molecular formula | C14H22BClN2O3 |
|---|---|
| Molecular weight | 312.60 g/mol |
| IUPAC name | 2-chloro-1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazole |
| InChIKey | PWGDGTMRINKIRS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N2C3CCCCO3)Cl |
Computed by PubChem (NCBI)