cas: 62584-32-1 — see every product listed under this CAS number, including other names
2-Chloro-3-(trifluoromethyl)benzonitrile 97% (CAS 62584-32-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A245650-250mg |
| cas | 62584-32-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 704.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A245650 |
2-chloro-3-(trifluoromethyl)benzonitrile (CAS 62584-32-1) is a chemical compound with the molecular formula C8H3ClF3N and a molecular weight of 205.56 g/mol. IUPAC name: 2-chloro-3-(trifluoromethyl)benzonitrile. InChIKey: GANPUEIPQFDYQA-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3N |
|---|---|
| Molecular weight | 205.56 g/mol |
| IUPAC name | 2-chloro-3-(trifluoromethyl)benzonitrile |
| InChIKey | GANPUEIPQFDYQA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(F)(F)F)Cl)C#N |
Computed by PubChem (NCBI)