cas: 136812-19-6 — see every product listed under this CAS number, including other names
2-Chloro-3-Quinolinecarbonyl Chloride, 95%, 95% (CAS 136812-19-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110BCM-100mg |
| cas | 136812-19-6 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 770.00 Pln | |
| Chemat | 250mg | 1250.00 Pln | |
| Chemat | 1g | 3011.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-chloroquinoline-3-carbonyl chloride (CAS 136812-19-6) is a chemical compound with the molecular formula C10H5Cl2NO and a molecular weight of 226.06 g/mol. IUPAC name: 2-chloroquinoline-3-carbonyl chloride. InChIKey: QZUMFCDPDBLWBV-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NO |
|---|---|
| Molecular weight | 226.06 g/mol |
| IUPAC name | 2-chloroquinoline-3-carbonyl chloride |
| InChIKey | QZUMFCDPDBLWBV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=N2)Cl)C(=O)Cl |
Computed by PubChem (NCBI)