cas: 878194-94-6 — see every product listed under this CAS number, including other names
2-Chloro-3-cyanopyridine-4-boronic acid pinacol ester, 95%(GC-MS),RG, 95%(GC-MS),RG (CAS 878194-94-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114GW8-100mg |
| cas | 878194-94-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 467.60 Pln | |
| Chemat | 250mg | 558.80 Pln | |
| Chemat | 1g | 2042.00 Pln |
| purity | 95%(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbonitrile (CAS 878194-94-6) is a chemical compound with the molecular formula C12H14BClN2O2 and a molecular weight of 264.52 g/mol. IUPAC name: 2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbonitrile. InChIKey: YYPZHORJYDCOSQ-UHFFFAOYSA-N.
| Molecular formula | C12H14BClN2O2 |
|---|---|
| Molecular weight | 264.52 g/mol |
| IUPAC name | 2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbonitrile |
| InChIKey | YYPZHORJYDCOSQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=NC=C2)Cl)C#N |
Computed by PubChem (NCBI)