2-Chloro-3-nitroaniline, 95%
cas: 3970-41-0 — see every product listed under this CAS number, including other names
2-Chloro-3-nitroaniline, 95% (CAS 3970-41-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A305705-250mg |
| cas | 3970-41-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 476.06 Pln | |
| Ambeed | 5g | 1471.75 Pln | |
| Ambeed | 10g | 2417.38 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 208.84 Pln | |
| BLDpharm | 1g | 469.86 Pln | |
| BLDpharm | 5g | 1580.58 Pln | |
| BLDpharm | 10g | 2602.44 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-chloro-3-nitroaniline (CAS 3970-41-0) is a chemical compound with the molecular formula C6H5ClN2O2 and a molecular weight of 172.57 g/mol. IUPAC name: 2-chloro-3-nitroaniline. InChIKey: CMYQDOILKQVRGN-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN2O2 |
|---|---|
| Molecular weight | 172.57 g/mol |
| IUPAC name | 2-chloro-3-nitroaniline |
| InChIKey | CMYQDOILKQVRGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])Cl)N |
Computed by PubChem (NCBI)