CAS 3531-19-9 appears in our catalog under these names: 6-Chloro-2,4-dinitroaniline, 6–Chloro–2,4–dinitroaniline, 2-Chloro-4,6-dinitroaniline, 97% . Offered by: Dr. Ehrenstorfer, GLPBio, Thermo Scientific (Alfa Aesar), HPC Standards. Available pack sizes: 100mg, 100g, 25g, 500g, 1x100mg.
2-chloro-4,6-dinitroaniline (CAS 3531-19-9) is a chemical compound with the molecular formula C6H4ClN3O4 and a molecular weight of 217.57 g/mol. IUPAC name: 2-chloro-4,6-dinitroaniline. InChIKey: LHRIICYSGQGXSX-UHFFFAOYSA-N.
| Molecular formula | C6H4ClN3O4 |
|---|---|
| Molecular weight | 217.57 g/mol |
| IUPAC name | 2-chloro-4,6-dinitroaniline |
| InChIKey | LHRIICYSGQGXSX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])N)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)