cas: 166770-70-3 — see every product listed under this CAS number, including other names
2-Chloro-4-(trifluoromethyl)pyridin-3-amine 98% (CAS 166770-70-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A803764-25g |
| cas | 166770-70-3 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 14387.87 Pln | |
| Ambeed | 250mg | 420.44 Pln | |
| Ambeed | 1g | 1093.50 Pln | |
| Ambeed | 5g | 4158.44 Pln | |
| Ambeed | 10g | 7228.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A803764 |
2-chloro-4-(trifluoromethyl)pyridin-3-amine (CAS 166770-70-3) is a chemical compound with the molecular formula C6H4ClF3N2 and a molecular weight of 196.56 g/mol. IUPAC name: 2-chloro-4-(trifluoromethyl)pyridin-3-amine. InChIKey: KFMUXCNJJIWKRE-UHFFFAOYSA-N.
| Molecular formula | C6H4ClF3N2 |
|---|---|
| Molecular weight | 196.56 g/mol |
| IUPAC name | 2-chloro-4-(trifluoromethyl)pyridin-3-amine |
| InChIKey | KFMUXCNJJIWKRE-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1C(F)(F)F)N)Cl |
Computed by PubChem (NCBI)