cas: 792952-51-3 — see every product listed under this CAS number, including other names
2-Chloro-4-hydroxy-5-nitrobenzoic acid 97% (CAS 792952-51-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A116741-100mg |
| cas | 792952-51-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 398.19 Pln | |
| Ambeed | 250mg | 676.31 Pln | |
| Ambeed | 1g | 1293.75 Pln | |
| Ambeed | 5g | 4353.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A116741 |
2-chloro-4-hydroxy-5-nitrobenzoic acid (CAS 792952-51-3) is a chemical compound with the molecular formula C7H4ClNO5 and a molecular weight of 217.56 g/mol. IUPAC name: 2-chloro-4-hydroxy-5-nitrobenzoic acid. InChIKey: POXKNUFPZVKHIL-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO5 |
|---|---|
| Molecular weight | 217.56 g/mol |
| IUPAC name | 2-chloro-4-hydroxy-5-nitrobenzoic acid |
| InChIKey | POXKNUFPZVKHIL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])O)Cl)C(=O)O |
Computed by PubChem (NCBI)