cas: 1138444-01-5 — see every product listed under this CAS number, including other names
2-Chloro-4-iodo-3-(trimethylsilyl)pyridine (CAS 1138444-01-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11052J-50mg |
| cas | 1138444-01-5 |
| size | 50mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 371.60 Pln | |
| Chemat | 250mg | 1067.60 Pln |
| delivery time | 3 weeks |
|---|
(2-chloro-4-iodo-3-pyridinyl)-trimethylsilane (CAS 1138444-01-5) is a chemical compound with the molecular formula C8H11ClINSi and a molecular weight of 311.62 g/mol. IUPAC name: (2-chloro-4-iodo-3-pyridinyl)-trimethylsilane. InChIKey: RXQKTAFCWPMXTO-UHFFFAOYSA-N.
| Molecular formula | C8H11ClINSi |
|---|---|
| Molecular weight | 311.62 g/mol |
| IUPAC name | (2-chloro-4-iodo-3-pyridinyl)-trimethylsilane |
| InChIKey | RXQKTAFCWPMXTO-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=C(C=CN=C1Cl)I |
Computed by PubChem (NCBI)