cas: 292138-59-1 — see every product listed under this CAS number, including other names
2-Chloro-4-methylthiazole-5-sulfonyl chloride, 98% (CAS 292138-59-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A740040-10g |
| cas | 292138-59-1 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 4334.05 Pln | |
| Fluorochem | 250mg | 508.17 Pln | |
| Fluorochem | 1g | 1231.88 Pln | |
| Fluorochem | 5g | 3538.36 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-chloro-4-methyl-1,3-thiazole-5-sulfonyl chloride (CAS 292138-59-1) is a chemical compound with the molecular formula C4H3Cl2NO2S2 and a molecular weight of 232.1 g/mol. IUPAC name: 2-chloro-4-methyl-1,3-thiazole-5-sulfonyl chloride. InChIKey: IBMLFZUEKAQELM-UHFFFAOYSA-N.
| Molecular formula | C4H3Cl2NO2S2 |
|---|---|
| Molecular weight | 232.1 g/mol |
| IUPAC name | 2-chloro-4-methyl-1,3-thiazole-5-sulfonyl chloride |
| InChIKey | IBMLFZUEKAQELM-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)