cas: 119047-14-2 — see every product listed under this CAS number, including other names
2-Chloro-4-nitrophenyl-α-D-glucopyranoside (CAS 119047-14-2) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 50mg, 100mg, 1g, 250mg, 500mg, 50 mg, 10 mg. Offered by: TargetMol, Chemat, MedChemExpress.
| brand | TargetMol |
|---|---|
| catalog number | T37835-10mg |
| cas | 119047-14-2 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| TargetMol | 10mg | 890.92 Pln | |
| TargetMol | 50mg | 3088.91 Pln | |
| TargetMol | 100mg | 5153.86 Pln | |
| Chemat | 100mg | 2077.05 Pln | |
| Chemat | 1g | 9147.47 Pln | |
| Chemat | 250mg | 3659.34 Pln | |
| Chemat | 500mg | 5834.43 Pln | |
| Chemat | 50mg | 1433.42 Pln | |
| MedChemExpress | 50 mg | 2051.90 Pln | |
| MedChemExpress | 10 mg | 584.40 Pln |
| purity | No data |
|---|---|
| delivery time | on request |
(2R,3R,4S,5S,6R)-2-(2-chloro-4-nitrophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 119047-14-2) is a chemical compound with the molecular formula C12H14ClNO8 and a molecular weight of 335.69 g/mol. IUPAC name: (2R,3R,4S,5S,6R)-2-(2-chloro-4-nitrophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: PJCVBKZRKNFZOD-ZIQFBCGOSA-N.
| Molecular formula | C12H14ClNO8 |
|---|---|
| Molecular weight | 335.69 g/mol |
| IUPAC name | (2R,3R,4S,5S,6R)-2-(2-chloro-4-nitrophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | PJCVBKZRKNFZOD-ZIQFBCGOSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Cl)O[C@@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)