2-Chloro-4-phenylquinazoline, 98%
cas: 29874-83-7 — see every product listed under this CAS number, including other names
2-Chloro-4-phenylquinazoline, 98% (CAS 29874-83-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 50g, 250g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A127800-1g |
| cas | 29874-83-7 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 248.00 Pln | |
| Ambeed | 100g | 676.31 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 136.64 Pln | |
| BLDpharm | 10g | 153.30 Pln | |
| BLDpharm | 25g | 264.38 Pln | |
| BLDpharm | 100g | 725.32 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 117.20 Pln | |
| Chemat | 25g | 189.20 Pln | |
| Chemat | 50g | 304.40 Pln | |
| Chemat | 100g | 539.60 Pln | |
| Chemat | 250g | 1245.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-chloro-4-phenylquinazoline (CAS 29874-83-7) is a chemical compound with the molecular formula C14H9ClN2 and a molecular weight of 240.69 g/mol. IUPAC name: 2-chloro-4-phenylquinazoline. InChIKey: SFKMVPQJJGJCMI-UHFFFAOYSA-N.
| Molecular formula | C14H9ClN2 |
|---|---|
| Molecular weight | 240.69 g/mol |
| IUPAC name | 2-chloro-4-phenylquinazoline |
| InChIKey | SFKMVPQJJGJCMI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC3=CC=CC=C32)Cl |
Computed by PubChem (NCBI)
