cas: 1003845-08-6 — see every product listed under this CAS number, including other names
2-Chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine 98% (CAS 1003845-08-6) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1477072-500g |
| cas | 1003845-08-6 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 7401.38 Pln | |
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 192.38 Pln | |
| Ambeed | 25g | 537.25 Pln | |
| Ambeed | 100g | 1905.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1477072 |
2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine (CAS 1003845-08-6) is a chemical compound with the molecular formula C10H14BClN2O2 and a molecular weight of 240.50 g/mol. IUPAC name: 2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine. InChIKey: VLAPDEKXZLRRKV-UHFFFAOYSA-N.
| Molecular formula | C10H14BClN2O2 |
|---|---|
| Molecular weight | 240.50 g/mol |
| IUPAC name | 2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
| InChIKey | VLAPDEKXZLRRKV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)Cl |
Computed by PubChem (NCBI)