cas: 72587-18-9 — see every product listed under this CAS number, including other names
2-Chloro-5-(trifluoromethyl)pyridin-3-amine, 98%, 98% (CAS 72587-18-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FC5L-250mg |
| cas | 72587-18-9 |
| size | 250mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 155.60 Pln | |
| Chemat | 10g | 242.00 Pln | |
| Chemat | 25g | 506.00 Pln | |
| Chemat | 100g | 1802.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-chloro-5-(trifluoromethyl)pyridin-3-amine (CAS 72587-18-9) is a chemical compound with the molecular formula C6H4ClF3N2 and a molecular weight of 196.56 g/mol. IUPAC name: 2-chloro-5-(trifluoromethyl)pyridin-3-amine. InChIKey: HABKYPVMMHBOIW-UHFFFAOYSA-N.
| Molecular formula | C6H4ClF3N2 |
|---|---|
| Molecular weight | 196.56 g/mol |
| IUPAC name | 2-chloro-5-(trifluoromethyl)pyridin-3-amine |
| InChIKey | HABKYPVMMHBOIW-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1N)Cl)C(F)(F)F |
Computed by PubChem (NCBI)