cas: 13290-74-9 — see every product listed under this CAS number, including other names
2-Chloro-5-nitrotoluene, >98.0%(GC) (CAS 13290-74-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | C1233-25G |
| cas | 13290-74-9 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 301.77 Pln | |
| TCI | 500g | 1831.04 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
1-chloro-2-methyl-4-nitrobenzene (CAS 13290-74-9) is a chemical compound with the molecular formula C7H6ClNO2 and a molecular weight of 171.58 g/mol. IUPAC name: 1-chloro-2-methyl-4-nitrobenzene. InChIKey: BGDCQZFFNFXYQC-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO2 |
|---|---|
| Molecular weight | 171.58 g/mol |
| IUPAC name | 1-chloro-2-methyl-4-nitrobenzene |
| InChIKey | BGDCQZFFNFXYQC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)