cas: 498548-90-6 — see every product listed under this CAS number, including other names
2-Chloro-6-ethylquinoline-3-carbonitrile, ≥97%, ≥97% (CAS 498548-90-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DK3E-100mg |
| cas | 498548-90-6 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 458.00 Pln | |
| Chemat | 250mg | 851.60 Pln | |
| Chemat | 1g | 2426.00 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
2-chloro-6-ethylquinoline-3-carbonitrile (CAS 498548-90-6) is a chemical compound with the molecular formula C12H9ClN2 and a molecular weight of 216.66 g/mol. IUPAC name: 2-chloro-6-ethylquinoline-3-carbonitrile. InChIKey: ZZBSVGBZSYQFSD-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN2 |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | 2-chloro-6-ethylquinoline-3-carbonitrile |
| InChIKey | ZZBSVGBZSYQFSD-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=CC(=C(N=C2C=C1)Cl)C#N |
Computed by PubChem (NCBI)