cas: 77119-53-0 — see every product listed under this CAS number, including other names
2-Chloro-6-fluoroquinoline 95% (CAS 77119-53-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A139137-250mg |
| cas | 77119-53-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 743.06 Pln | |
| Ambeed | 5g | 2517.50 Pln | |
| Ambeed | 10g | 3735.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A139137 |
2-chloro-6-fluoroquinoline (CAS 77119-53-0) is a chemical compound with the molecular formula C9H5ClFN and a molecular weight of 181.59 g/mol. IUPAC name: 2-chloro-6-fluoroquinoline. InChIKey: USAYWGMYCNWTGO-UHFFFAOYSA-N.
| Molecular formula | C9H5ClFN |
|---|---|
| Molecular weight | 181.59 g/mol |
| IUPAC name | 2-chloro-6-fluoroquinoline |
| InChIKey | USAYWGMYCNWTGO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=N2)Cl)C=C1F |
Computed by PubChem (NCBI)