cas: 749920-54-5 — see every product listed under this CAS number, including other names
2-Chloro-6-fluoroquinoline-3-carbaldehyde, 97%, 97% (CAS 749920-54-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116ROY-100mg |
| cas | 749920-54-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 405.20 Pln | |
| Chemat | 250mg | 630.80 Pln | |
| Chemat | 500mg | 880.40 Pln | |
| Chemat | 1g | 1072.40 Pln | |
| Chemat | 5g | 3736.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-chloro-6-fluoroquinoline-3-carbaldehyde (CAS 749920-54-5) is a chemical compound with the molecular formula C10H5ClFNO and a molecular weight of 209.60 g/mol. IUPAC name: 2-chloro-6-fluoroquinoline-3-carbaldehyde. InChIKey: AWXUFNXARKHKDY-UHFFFAOYSA-N.
| Molecular formula | C10H5ClFNO |
|---|---|
| Molecular weight | 209.60 g/mol |
| IUPAC name | 2-chloro-6-fluoroquinoline-3-carbaldehyde |
| InChIKey | AWXUFNXARKHKDY-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=C(C=C2C=C1F)C=O)Cl |
Computed by PubChem (NCBI)