cas: 1421311-91-2 — see every product listed under this CAS number, including other names
2-Chloro-7,8-dihydro-6H-pyrido[3,2-d]pyrimidine-5-carboxylic acid tert-butyl... (CAS 1421311-91-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg. Offered by: Roth.
| brand | Roth |
|---|---|
| catalog number | ROTH-330H.2 |
| cas | 1421311-91-2 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Roth | 50mg | 1127.99 Pln | |
| Roth | 100mg | 1788.73 Pln | |
| Roth | 250mg | 3299.00 Pln | |
| Roth | 500mg | 5309.56 Pln |
| delivery time | 2 week |
|---|
Tert-butyl 2-chloro-7,8-dihydro-6H-pyrido[3,2-d]pyrimidine-5-carboxylate (CAS 1421311-91-2) is a chemical compound with the molecular formula C12H16ClN3O2 and a molecular weight of 269.73 g/mol. IUPAC name: tert-butyl 2-chloro-7,8-dihydro-6H-pyrido[3,2-d]pyrimidine-5-carboxylate. InChIKey: NIVWSHYBKCXEMR-UHFFFAOYSA-N.
| Molecular formula | C12H16ClN3O2 |
|---|---|
| Molecular weight | 269.73 g/mol |
| IUPAC name | tert-butyl 2-chloro-7,8-dihydro-6H-pyrido[3,2-d]pyrimidine-5-carboxylate |
| InChIKey | NIVWSHYBKCXEMR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2=NC(=NC=C21)Cl |
Computed by PubChem (NCBI)