cas: 445041-65-6 — see every product listed under this CAS number, including other names
2-Chloro-7-fluoroquinoline, 98% (CAS 445041-65-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F621323-100MG |
| cas | 445041-65-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 419.66 Pln | |
| Fluorochem | 250mg | 560.24 Pln | |
| Fluorochem | 1g | 1393.28 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-chloro-7-fluoroquinoline (CAS 445041-65-6) is a chemical compound with the molecular formula C9H5ClFN and a molecular weight of 181.59 g/mol. IUPAC name: 2-chloro-7-fluoroquinoline. InChIKey: CZWRXWIIFBLBEH-UHFFFAOYSA-N.
| Molecular formula | C9H5ClFN |
|---|---|
| Molecular weight | 181.59 g/mol |
| IUPAC name | 2-chloro-7-fluoroquinoline |
| InChIKey | CZWRXWIIFBLBEH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=N2)Cl)F |
Computed by PubChem (NCBI)