cas: 382602-31-5 — see every product listed under this CAS number, including other names
2-Chloro-9,9-dimethyl-9H-fluorene, 95%, 95% (CAS 382602-31-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I8J6-100mg |
| cas | 382602-31-5 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 371.60 Pln | |
| Chemat | 5g | 750.80 Pln | |
| Chemat | 10g | 1096.40 Pln | |
| Chemat | 25g | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-chloro-9,9-dimethylfluorene (CAS 382602-31-5) is a chemical compound with the molecular formula C15H13Cl and a molecular weight of 228.71 g/mol. IUPAC name: 2-chloro-9,9-dimethylfluorene. InChIKey: ANDIDBWHCQXRAM-UHFFFAOYSA-N.
| Molecular formula | C15H13Cl |
|---|---|
| Molecular weight | 228.71 g/mol |
| IUPAC name | 2-chloro-9,9-dimethylfluorene |
| InChIKey | ANDIDBWHCQXRAM-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C1C=C(C=C3)Cl)C |
Computed by PubChem (NCBI)