cas: 87864-14-0 — see every product listed under this CAS number, including other names
2-Chloro-N-(2-(diethylamino)ethyl)quinoline-4-carboxamide, 98% (CAS 87864-14-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A268400-10g |
| cas | 87864-14-0 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 1599.85 Pln | |
| AmBeed | 25g | 3448.69 Pln | |
| Fluorochem | 5g | 388.42 Pln | |
| Fluorochem | 10g | 726.85 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-chloro-N-[2-(diethylamino)ethyl]quinoline-4-carboxamide (CAS 87864-14-0) is a chemical compound with the molecular formula C16H20ClN3O and a molecular weight of 305.80 g/mol. IUPAC name: 2-chloro-N-[2-(diethylamino)ethyl]quinoline-4-carboxamide. InChIKey: WZBLJANCSMJDSS-UHFFFAOYSA-N.
| Molecular formula | C16H20ClN3O |
|---|---|
| Molecular weight | 305.80 g/mol |
| IUPAC name | 2-chloro-N-[2-(diethylamino)ethyl]quinoline-4-carboxamide |
| InChIKey | WZBLJANCSMJDSS-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNC(=O)C1=CC(=NC2=CC=CC=C21)Cl |
Computed by PubChem (NCBI)