cas: 923744-15-4 — see every product listed under this CAS number, including other names
2-Chloro-N-{10,13-dioxa-4-thia-6-azatricyclo(7.4.0.0,3,7)trideca-1(9),2,5,7-tetraen-5-yl}acetamide, 95% (CAS 923744-15-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1081735-10g |
| cas | 923744-15-4 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 16065.07 Pln | |
| AmBeed | 5g | 10733.38 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-chloro-N-(6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-yl)acetamide (CAS 923744-15-4) is a chemical compound with the molecular formula C11H9ClN2O3S and a molecular weight of 284.72 g/mol. IUPAC name: 2-chloro-N-(6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-yl)acetamide. InChIKey: PLSACAYSJPRTBK-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2O3S |
|---|---|
| Molecular weight | 284.72 g/mol |
| IUPAC name | 2-chloro-N-(6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-yl)acetamide |
| InChIKey | PLSACAYSJPRTBK-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C3C(=C2)SC(=N3)NC(=O)CCl |
Computed by PubChem (NCBI)