cas: 18637-02-0 — see every product listed under this CAS number, including other names
2-Chloro-benzamidine hydrochloride, 97% (CAS 18637-02-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F049071-1G |
| cas | 18637-02-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 263.47 Pln | |
| Fluorochem | 5g | 591.48 Pln | |
| Fluorochem | 10g | 945.52 Pln | |
| Fluorochem | 25g | 2262.76 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-chlorobenzenecarboximidamide;hydrochloride (CAS 18637-02-0) is a chemical compound with the molecular formula C7H8Cl2N2 and a molecular weight of 191.05 g/mol. IUPAC name: 2-chlorobenzenecarboximidamide;hydrochloride. InChIKey: KVMVAFKWEWLDPU-UHFFFAOYSA-N.
| Molecular formula | C7H8Cl2N2 |
|---|---|
| Molecular weight | 191.05 g/mol |
| IUPAC name | 2-chlorobenzenecarboximidamide;hydrochloride |
| InChIKey | KVMVAFKWEWLDPU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=N)N)Cl.Cl |
Computed by PubChem (NCBI)