cas: 857653-85-1 — see every product listed under this CAS number, including other names
2-Chloro-n'-hydroxy-4-pyridinecarboximidamide, 96%, 96% (CAS 857653-85-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G5H9-250mg |
| cas | 857653-85-1 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 362.00 Pln | |
| Chemat | 5g | 1106.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-chloro-N'-hydroxypyridine-4-carboximidamide (CAS 857653-85-1) is a chemical compound with the molecular formula C6H6ClN3O and a molecular weight of 171.58 g/mol. IUPAC name: 2-chloro-N'-hydroxypyridine-4-carboximidamide. InChIKey: FUSMRNWUUNGSEH-UHFFFAOYSA-N.
| Molecular formula | C6H6ClN3O |
|---|---|
| Molecular weight | 171.58 g/mol |
| IUPAC name | 2-chloro-N'-hydroxypyridine-4-carboximidamide |
| InChIKey | FUSMRNWUUNGSEH-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1/C(=N/O)/N)Cl |
Computed by PubChem (NCBI)