2-Chlorobenzo[d]thiazol-7-amine, 97%
cas: 1782641-10-4 — see every product listed under this CAS number, including other names
2-Chlorobenzo[d]thiazol-7-amine, 97% (CAS 1782641-10-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A541990-100mg |
| cas | 1782641-10-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 197.94 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 893.25 Pln | |
| Ambeed | 5g | 3246.19 Pln | |
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 357.20 Pln | |
| Chemat | 1g | 832.40 Pln | |
| Chemat | 5g | 2762.00 Pln | |
| Fluorochem | 100mg | 195.78 Pln | |
| Fluorochem | 250mg | 367.60 Pln | |
| BLDpharm | 100mg | 208.84 Pln | |
| BLDpharm | 250mg | 375.45 Pln | |
| BLDpharm | 1g | 869.72 Pln | |
| BLDpharm | 5g | 2874.57 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-chloro-1,3-benzothiazol-7-amine (CAS 1782641-10-4) is a chemical compound with the molecular formula C7H5ClN2S and a molecular weight of 184.65 g/mol. IUPAC name: 2-chloro-1,3-benzothiazol-7-amine. InChIKey: UCQKSFXZSSOCIF-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2S |
|---|---|
| Molecular weight | 184.65 g/mol |
| IUPAC name | 2-chloro-1,3-benzothiazol-7-amine |
| InChIKey | UCQKSFXZSSOCIF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)N=C(S2)Cl)N |
Computed by PubChem (NCBI)