cas: 88-16-4 — see every product listed under this CAS number, including other names
2-Chlorobenzotrifluoride, >98.0%(GC) (CAS 88-16-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | C0303-25G |
| cas | 88-16-4 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 188.68 Pln | |
| TCI | 500g | 586.97 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
1-chloro-2-(trifluoromethyl)benzene (CAS 88-16-4) is a chemical compound with the molecular formula C7H4ClF3 and a molecular weight of 180.55 g/mol. IUPAC name: 1-chloro-2-(trifluoromethyl)benzene. InChIKey: DGRVQOKCSKDWIH-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3 |
|---|---|
| Molecular weight | 180.55 g/mol |
| IUPAC name | 1-chloro-2-(trifluoromethyl)benzene |
| InChIKey | DGRVQOKCSKDWIH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)