cas: 28442-78-6 — see every product listed under this CAS number, including other names
2-Chloroisophthalonitrile, 98%, 98% (CAS 28442-78-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BFJS-100mg |
| cas | 28442-78-6 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 342.80 Pln | |
| Chemat | 250mg | 462.80 Pln | |
| Chemat | 1g | 1082.00 Pln | |
| Chemat | 5g | 3246.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-chlorobenzene-1,3-dicarbonitrile (CAS 28442-78-6) is a chemical compound with the molecular formula C8H3ClN2 and a molecular weight of 162.57 g/mol. IUPAC name: 2-chlorobenzene-1,3-dicarbonitrile. InChIKey: KELQMIQLTBTJNV-UHFFFAOYSA-N.
| Molecular formula | C8H3ClN2 |
|---|---|
| Molecular weight | 162.57 g/mol |
| IUPAC name | 2-chlorobenzene-1,3-dicarbonitrile |
| InChIKey | KELQMIQLTBTJNV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C#N)Cl)C#N |
Computed by PubChem (NCBI)