2-Chloropyrimidine-4,5-diamine, 97%
cas: 14631-08-4 — see every product listed under this CAS number, including other names
2-Chloropyrimidine-4,5-diamine, 97% (CAS 14631-08-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 10g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A159308-250mg |
| cas | 14631-08-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 526.12 Pln | |
| Ambeed | 25g | 2183.75 Pln | |
| BLDpharm | 100mg | 125.54 Pln | |
| BLDpharm | 250mg | 147.75 Pln | |
| BLDpharm | 1g | 203.29 Pln | |
| BLDpharm | 5g | 558.72 Pln | |
| BLDpharm | 25g | 2346.98 Pln | |
| Fluorochem | 100mg | 102.06 Pln | |
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 539.41 Pln | |
| Fluorochem | 10g | 961.14 Pln | |
| Fluorochem | 25g | 2241.94 Pln | |
| Fluorochem | 250mg | 112.48 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-chloropyrimidine-4,5-diamine (CAS 14631-08-4) is a chemical compound with the molecular formula C4H5ClN4 and a molecular weight of 144.56 g/mol. IUPAC name: 2-chloropyrimidine-4,5-diamine. InChIKey: QDUJVEOOSNUDDW-UHFFFAOYSA-N.
| Molecular formula | C4H5ClN4 |
|---|---|
| Molecular weight | 144.56 g/mol |
| IUPAC name | 2-chloropyrimidine-4,5-diamine |
| InChIKey | QDUJVEOOSNUDDW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=N1)Cl)N)N |
Computed by PubChem (NCBI)
Synonyms:
2-Chloropyrimidine-4,5-diamine, 4,5-Pyrimidinediamine, 2-chloro-, 2-Chloro-4,5-pyrimidinediamine, InChI=1/C4H5ClN4/c5-2-1-3(6)9-4(7)8-2/h1H,(H4,6,7,8,9), QJIUMVUZDYPQRT-UHFFFAOYSA-, 2-Chloro-4,5-diaminopyrimidine, 4,5-Diamino-2-chloropyrimidine, Pyrimidine, 4,5-diamino-2-chloro-, 2-Chloro-pyrimidine-4,5-diamine, 2-Chloro-4,5-pyrimidinediamine #