2-Chloroquinolin-5-amine, 95%
cas: 607377-99-1 — see every product listed under this CAS number, including other names
2-Chloroquinolin-5-amine, 95% (CAS 607377-99-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A696867-250mg |
| cas | 607377-99-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1627.50 Pln | |
| Ambeed | 1g | 4269.69 Pln | |
| Chemat | 50mg | 477.20 Pln | |
| Chemat | 100mg | 765.20 Pln | |
| Chemat | 250mg | 1259.60 Pln | |
| BLDpharm | 50mg | 603.15 Pln | |
| BLDpharm | 100mg | 969.68 Pln | |
| BLDpharm | 250mg | 1591.69 Pln | |
| BLDpharm | 1g | 4185.22 Pln | |
| Fluorochem | 50mg | 872.63 Pln | |
| Fluorochem | 100mg | 1419.31 Pln | |
| Fluorochem | 250mg | 2335.65 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-chloroquinolin-5-amine (CAS 607377-99-1) is a chemical compound with the molecular formula C9H7ClN2 and a molecular weight of 178.62 g/mol. IUPAC name: 2-chloroquinolin-5-amine. InChIKey: FVYURTHPFIWJFB-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2 |
|---|---|
| Molecular weight | 178.62 g/mol |
| IUPAC name | 2-chloroquinolin-5-amine |
| InChIKey | FVYURTHPFIWJFB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=CC(=NC2=C1)Cl)N |
Computed by PubChem (NCBI)