cas: 70763-62-1 — see every product listed under this CAS number, including other names
2-Deoxy-2-fluoro-L-fucose, 97.00% (CAS 70763-62-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10mg, 25mg, 50mg, 5mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM88360C-100mg |
| cas | 70763-62-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 11583.62 Pln | |
| Chemat | 10mg | 2406.67 Pln | |
| Chemat | 25mg | 4435.60 Pln | |
| Chemat | 50mg | 7122.69 Pln | |
| Chemat | 5mg | 1646.36 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 97.00% |
| category | Chemicals |
(2S,3R,4R,5S)-2-fluoro-3,4,5-trihydroxyhexanal (CAS 70763-62-1) is a chemical compound with the molecular formula C6H11FO4 and a molecular weight of 166.15 g/mol. IUPAC name: (2S,3R,4R,5S)-2-fluoro-3,4,5-trihydroxyhexanal. InChIKey: SQTFKIKSQNCWGJ-KCDKBNATSA-N.
| Molecular formula | C6H11FO4 |
|---|---|
| Molecular weight | 166.15 g/mol |
| IUPAC name | (2S,3R,4R,5S)-2-fluoro-3,4,5-trihydroxyhexanal |
| InChIKey | SQTFKIKSQNCWGJ-KCDKBNATSA-N |
| SMILES | C[C@@H]([C@H]([C@H]([C@@H](C=O)F)O)O)O |
Computed by PubChem (NCBI)