Products 1809157-96-7
CAS 1809157-96-7 appears in our catalog under these names: 2-Ethoxy-5-fluoroisonicotinic acid, 95%, 2-Ethoxy-5-fluoroisonicotinic acid, 98%, 2-Ethoxy-5-fluoroisonicotinic acid, ≥95%, ≥95%, 2-ETHOXY-5-FLUOROISONICOTINIC ACID, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 10g.
2-ethoxy-5-fluoropyridine-4-carboxylic acid (CAS 1809157-96-7) is a chemical compound with the molecular formula C8H8FNO3 and a molecular weight of 185.15 g/mol. IUPAC name: 2-ethoxy-5-fluoropyridine-4-carboxylic acid. InChIKey: GYRJYVIAPHVUJC-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO3 |
|---|---|
| Molecular weight | 185.15 g/mol |
| IUPAC name | 2-ethoxy-5-fluoropyridine-4-carboxylic acid |
| InChIKey | GYRJYVIAPHVUJC-UHFFFAOYSA-N |
| SMILES | CCOC1=NC=C(C(=C1)C(=O)O)F |
Computed by PubChem (NCBI)