cas: 848243-23-2 — see every product listed under this CAS number, including other names
2-Ethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine 97% (CAS 848243-23-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A166841-1g |
| cas | 848243-23-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 698.56 Pln | |
| Ambeed | 10g | 1115.75 Pln | |
| Ambeed | 25g | 2506.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A166841 |
2-ethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 848243-23-2) is a chemical compound with the molecular formula C13H20BNO3 and a molecular weight of 249.12 g/mol. IUPAC name: 2-ethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: GRXNEZGBXVIORK-UHFFFAOYSA-N.
| Molecular formula | C13H20BNO3 |
|---|---|
| Molecular weight | 249.12 g/mol |
| IUPAC name | 2-ethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | GRXNEZGBXVIORK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N=CC=C2)OCC |
Computed by PubChem (NCBI)