cas: 1486485-51-1 — see every product listed under this CAS number, including other names
2-Ethyl-1-{(4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methyl}pyrrolidine, 98% (CAS 1486485-51-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A844631-5g |
| cas | 1486485-51-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 30959.95 Pln | |
| AmBeed | 10g | 45854.83 Pln | |
| AmBeed | 1g | 10733.38 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-ethyl-1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidine (CAS 1486485-51-1) is a chemical compound with the molecular formula C19H30BNO2 and a molecular weight of 315.3 g/mol. IUPAC name: 2-ethyl-1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidine. InChIKey: DYOJXUDQASRTCZ-UHFFFAOYSA-N.
| Molecular formula | C19H30BNO2 |
|---|---|
| Molecular weight | 315.3 g/mol |
| IUPAC name | 2-ethyl-1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]pyrrolidine |
| InChIKey | DYOJXUDQASRTCZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CN3CCCC3CC |
Computed by PubChem (NCBI)