CAS 103264-62-6 is the registry number for 2-Ethyl-4-methoxybenzoic acid, 98%. Offered by: AmBeed. Available pack sizes: 5g.
2-ethyl-4-methoxybenzoic acid (CAS 103264-62-6) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 2-ethyl-4-methoxybenzoic acid. InChIKey: USJWJQZAWFTHCO-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 2-ethyl-4-methoxybenzoic acid |
| InChIKey | USJWJQZAWFTHCO-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=CC(=C1)OC)C(=O)O |
Computed by PubChem (NCBI)