cas: 745784-10-5 — see every product listed under this CAS number, including other names
2-FLUOROQUINOLINE-3-BORONIC ACID, 84%, 84% (CAS 745784-10-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BNC-100mg |
| cas | 745784-10-5 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 285.20 Pln | |
| Chemat | 500mg | 491.60 Pln | |
| Chemat | 1g | 875.60 Pln |
| purity | 84% |
|---|---|
| delivery time | 3 weeks |
(2-fluoroquinolin-3-yl)boronic acid (CAS 745784-10-5) is a chemical compound with the molecular formula C9H7BFNO2 and a molecular weight of 190.97 g/mol. IUPAC name: (2-fluoroquinolin-3-yl)boronic acid. InChIKey: SAUJOURLTDSVOK-UHFFFAOYSA-N.
| Molecular formula | C9H7BFNO2 |
|---|---|
| Molecular weight | 190.97 g/mol |
| IUPAC name | (2-fluoroquinolin-3-yl)boronic acid |
| InChIKey | SAUJOURLTDSVOK-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=CC=CC=C2N=C1F)(O)O |
Computed by PubChem (NCBI)