cas: 1803800-12-5 — see every product listed under this CAS number, including other names
2-Fluoro-3-methyl-4-phenylpyridine (CAS 1803800-12-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F628442-1G |
| cas | 1803800-12-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 7510.91 Pln | |
| Fluorochem | 5g | 22411.92 Pln |
| delivery time | 3-4 weeks |
|---|
2-fluoro-3-methyl-4-phenylpyridine (CAS 1803800-12-5) is a chemical compound with the molecular formula C12H10FN and a molecular weight of 187.21 g/mol. IUPAC name: 2-fluoro-3-methyl-4-phenylpyridine. InChIKey: RBTVRSCLWHFQIQ-UHFFFAOYSA-N.
| Molecular formula | C12H10FN |
|---|---|
| Molecular weight | 187.21 g/mol |
| IUPAC name | 2-fluoro-3-methyl-4-phenylpyridine |
| InChIKey | RBTVRSCLWHFQIQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CN=C1F)C2=CC=CC=C2 |
Computed by PubChem (NCBI)