cas: 1197193-42-2 — see every product listed under this CAS number, including other names
2-Fluoro-4-(4-methylpiperazin-1-yl)benzaldehyde (CAS 1197193-42-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F446601-1G |
| cas | 1197193-42-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1185.02 Pln | |
| Fluorochem | 5g | 3017.71 Pln | |
| Fluorochem | 10g | 5089.89 Pln | |
| Fluorochem | 25g | 8921.88 Pln |
| delivery time | 3-4 weeks |
|---|
2-fluoro-4-(4-methylpiperazin-1-yl)benzaldehyde (CAS 1197193-42-2) is a chemical compound with the molecular formula C12H15FN2O and a molecular weight of 222.26 g/mol. IUPAC name: 2-fluoro-4-(4-methylpiperazin-1-yl)benzaldehyde. InChIKey: YZBVGNIPKBFUIS-UHFFFAOYSA-N.
| Molecular formula | C12H15FN2O |
|---|---|
| Molecular weight | 222.26 g/mol |
| IUPAC name | 2-fluoro-4-(4-methylpiperazin-1-yl)benzaldehyde |
| InChIKey | YZBVGNIPKBFUIS-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC(=C(C=C2)C=O)F |
Computed by PubChem (NCBI)