cas: 1392234-97-7 — see every product listed under this CAS number, including other names
2-Fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol 95% (CAS 1392234-97-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A268475-250mg |
| cas | 1392234-97-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 437.12 Pln | |
| Ambeed | 5g | 1327.12 Pln | |
| Ambeed | 25g | 4469.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A268475 |
2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 1392234-97-7) is a chemical compound with the molecular formula C12H16BFO3 and a molecular weight of 238.06 g/mol. IUPAC name: 2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: HMGMCEWHAKSNBV-UHFFFAOYSA-N.
| Molecular formula | C12H16BFO3 |
|---|---|
| Molecular weight | 238.06 g/mol |
| IUPAC name | 2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | HMGMCEWHAKSNBV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)F)O |
Computed by PubChem (NCBI)