cas: 1132832-80-4 — see every product listed under this CAS number, including other names
2-Fluoro-5-(thiophen-2-yl)pyridine 95+% (CAS 1132832-80-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A407735-250mg |
| cas | 1132832-80-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 398.19 Pln | |
| Ambeed | 5g | 1388.31 Pln |
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A407735 |
2-fluoro-5-thiophen-2-ylpyridine (CAS 1132832-80-4) is a chemical compound with the molecular formula C9H6FNS and a molecular weight of 179.22 g/mol. IUPAC name: 2-fluoro-5-thiophen-2-ylpyridine. InChIKey: ANWJEFDJHKCJNW-UHFFFAOYSA-N.
| Molecular formula | C9H6FNS |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 2-fluoro-5-thiophen-2-ylpyridine |
| InChIKey | ANWJEFDJHKCJNW-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CN=C(C=C2)F |
Computed by PubChem (NCBI)