Products 135564-61-3

CAS 135564-61-3 appears in our catalog under these names: 2-Fluoro-5-methylbenzoyl chloride, 97%, 2-Fluoro-5-methylbenzoyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 25g.

Structural formula: {0} (CAS {1})

2-fluoro-5-methylbenzoyl chloride (CAS 135564-61-3) is a chemical compound with the molecular formula C8H6ClFO and a molecular weight of 172.58 g/mol. IUPAC name: 2-fluoro-5-methylbenzoyl chloride. InChIKey: WVRZOPWHCFDYSQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6ClFO
Molecular weight172.58 g/mol
IUPAC name2-fluoro-5-methylbenzoyl chloride
InChIKeyWVRZOPWHCFDYSQ-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)F)C(=O)Cl

Computed by PubChem (NCBI)