2-Fluoro-6-(trifluoromethyl)benzamide
cas: 144851-59-2 — see every product listed under this CAS number, including other names
2-Fluoro-6-(trifluoromethyl)benzamide (CAS 144851-59-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F006390-1G |
| cas | 144851-59-2 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 263.47 Pln | |
| Fluorochem | 5g | 362.39 Pln | |
| Fluorochem | 10g | 659.16 Pln | |
| Fluorochem | 25g | 1252.70 Pln |
properties
| delivery time | 2-3 weeks |
|---|
2-fluoro-6-(trifluoromethyl)benzamide (CAS 144851-59-2) is a chemical compound with the molecular formula C8H5F4NO and a molecular weight of 207.12 g/mol. IUPAC name: 2-fluoro-6-(trifluoromethyl)benzamide. InChIKey: BYQGJCJJFXIYHC-UHFFFAOYSA-N.
| Molecular formula | C8H5F4NO |
|---|---|
| Molecular weight | 207.12 g/mol |
| IUPAC name | 2-fluoro-6-(trifluoromethyl)benzamide |
| InChIKey | BYQGJCJJFXIYHC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)N)C(F)(F)F |
Computed by PubChem (NCBI)