cas: 111771-12-1 — see every product listed under this CAS number, including other names
2-Fluoro-6-iodobenzoyl chloride 98% (CAS 111771-12-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A578064-250mg |
| cas | 111771-12-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 1010.06 Pln | |
| Ambeed | 10g | 1827.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A578064 |
2-fluoro-6-iodobenzoyl chloride (CAS 111771-12-1) is a chemical compound with the molecular formula C7H3ClFIO and a molecular weight of 284.45 g/mol. IUPAC name: 2-fluoro-6-iodobenzoyl chloride. InChIKey: KUULKUHCAMRGCF-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFIO |
|---|---|
| Molecular weight | 284.45 g/mol |
| IUPAC name | 2-fluoro-6-iodobenzoyl chloride |
| InChIKey | KUULKUHCAMRGCF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)I)C(=O)Cl)F |
Computed by PubChem (NCBI)