cas: 57075-81-7 — see every product listed under this CAS number, including other names
2-Fluorobenzimidamide hydrochloride 97% (CAS 57075-81-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A131820-250mg |
| cas | 57075-81-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 542.81 Pln | |
| Ambeed | 10g | 1004.50 Pln | |
| Ambeed | 25g | 2395.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A131820 |
2-fluorobenzenecarboximidamide;hydrochloride (CAS 57075-81-7) is a chemical compound with the molecular formula C7H8ClFN2 and a molecular weight of 174.60 g/mol. IUPAC name: 2-fluorobenzenecarboximidamide;hydrochloride. InChIKey: VCDJPGDATCBGMF-UHFFFAOYSA-N.
| Molecular formula | C7H8ClFN2 |
|---|---|
| Molecular weight | 174.60 g/mol |
| IUPAC name | 2-fluorobenzenecarboximidamide;hydrochloride |
| InChIKey | VCDJPGDATCBGMF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=N)N)F.Cl |
Computed by PubChem (NCBI)