cas: 383-50-6 — see every product listed under this CAS number, including other names
2-Fluoroethyl p-Toluenesulfonate, >98.0%(GC) (CAS 383-50-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | F1056-1G |
| cas | 383-50-6 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 349.46 Pln | |
| TCI | 5g | 1082.13 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
2-fluoroethyl 4-methylbenzenesulfonate (CAS 383-50-6) is a chemical compound with the molecular formula C9H11FO3S and a molecular weight of 218.25 g/mol. IUPAC name: 2-fluoroethyl 4-methylbenzenesulfonate. InChIKey: XNRDLSNSMTUXBV-UHFFFAOYSA-N.
| Molecular formula | C9H11FO3S |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 2-fluoroethyl 4-methylbenzenesulfonate |
| InChIKey | XNRDLSNSMTUXBV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCF |
Computed by PubChem (NCBI)