cas: 1352796-65-6 — see every product listed under this CAS number, including other names
2-Fluoropyrimidin-5-ylboronic acid pinacol ester, 95%, 95% (CAS 1352796-65-6) is a chemical reagent available from Chemat. Available pack sizes: 50g, 100g, 250g, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110FPZ-50g |
| cas | 1352796-65-6 |
| size | 50g |
| availability | 250g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 2786.00 Pln | |
| Chemat | 100g | 5219.60 Pln | |
| Chemat | 250g | 12237.20 Pln | |
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 261.20 Pln | |
| Chemat | 5g | 875.60 Pln | |
| Chemat | 10g | 1466.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine (CAS 1352796-65-6) is a chemical compound with the molecular formula C10H14BFN2O2 and a molecular weight of 224.04 g/mol. IUPAC name: 2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine. InChIKey: XFNGULIUEUPWIG-UHFFFAOYSA-N.
| Molecular formula | C10H14BFN2O2 |
|---|---|
| Molecular weight | 224.04 g/mol |
| IUPAC name | 2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
| InChIKey | XFNGULIUEUPWIG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)F |
Computed by PubChem (NCBI)