cas: 2121512-13-6 — see every product listed under this CAS number, including other names
2-Formyl-3-(morpholino)phenylboronic acid pinacol ester, ≥95%, ≥95% (CAS 2121512-13-6) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12KLZP-1g |
| cas | 2121512-13-6 |
| size | 1g |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 3054.80 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
2-morpholin-4-yl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 2121512-13-6) is a chemical compound with the molecular formula C17H24BNO4 and a molecular weight of 317.2 g/mol. IUPAC name: 2-morpholin-4-yl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: BUMPROFBFFJXDA-UHFFFAOYSA-N.
| Molecular formula | C17H24BNO4 |
|---|---|
| Molecular weight | 317.2 g/mol |
| IUPAC name | 2-morpholin-4-yl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | BUMPROFBFFJXDA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)N3CCOCC3)C=O |
Computed by PubChem (NCBI)