cas: 94239-06-2 — see every product listed under this CAS number, including other names
2-Hydrazino-6-(trifluoromethyl)pyridine, 95%, 95% (CAS 94239-06-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117CWZ-250mg |
| cas | 94239-06-2 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 390.80 Pln | |
| Chemat | 1g | 909.20 Pln | |
| Chemat | 5g | 2517.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[6-(trifluoromethyl)-2-pyridinyl]hydrazine (CAS 94239-06-2) is a chemical compound with the molecular formula C6H6F3N3 and a molecular weight of 177.13 g/mol. IUPAC name: [6-(trifluoromethyl)-2-pyridinyl]hydrazine. InChIKey: PWAIGTRIQMKRHC-UHFFFAOYSA-N.
| Molecular formula | C6H6F3N3 |
|---|---|
| Molecular weight | 177.13 g/mol |
| IUPAC name | [6-(trifluoromethyl)-2-pyridinyl]hydrazine |
| InChIKey | PWAIGTRIQMKRHC-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)NN)C(F)(F)F |
Computed by PubChem (NCBI)