cas: 926243-08-5 — see every product listed under this CAS number, including other names
2-Hydroxy-5-methanesulfonamidobenzoic acid 95% (CAS 926243-08-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1112185-100mg |
| cas | 926243-08-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 286.94 Pln | |
| Ambeed | 250mg | 409.31 Pln | |
| Ambeed | 1g | 1037.88 Pln | |
| Ambeed | 5g | 3318.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1112185 |
2-hydroxy-5-(methanesulfonamido)benzoic acid (CAS 926243-08-5) is a chemical compound with the molecular formula C8H9NO5S and a molecular weight of 231.23 g/mol. IUPAC name: 2-hydroxy-5-(methanesulfonamido)benzoic acid. InChIKey: BLKPCFNDGFDHEM-UHFFFAOYSA-N.
| Molecular formula | C8H9NO5S |
|---|---|
| Molecular weight | 231.23 g/mol |
| IUPAC name | 2-hydroxy-5-(methanesulfonamido)benzoic acid |
| InChIKey | BLKPCFNDGFDHEM-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=CC(=C(C=C1)O)C(=O)O |
Computed by PubChem (NCBI)